About 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one
1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one (PubChem CID 23465988) has the molecular formula C13H15Cl2N3O
and a molecular weight of 300.19 g/mol. Its IUPAC name is 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one.
Molecular Properties
| Compound Name | 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one |
| PubChem CID | 23465988 |
| Molecular Formula | C13H15Cl2N3O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCN=C1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2N3O/c1-2-3-12(19)18-7-6-16-13(18)17-11-5-4-9(14)8-10(11)15/h4-5,8H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | XWIJZWNDYBKSTJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one?
The IUPAC name of 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one (CID 23465988) is 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one.
What is the SMILES notation for 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one?
The canonical SMILES for 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one is CCCC(=O)N1CCN=C1Nc1ccc(Cl)cc1Cl.
What is the InChIKey of 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one?
The InChIKey is XWIJZWNDYBKSTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2N3O/c1-2-3-12(19)18-7-6-16-13(18)17-11-5-4-9(14)8-10(11)15/h4-5,8H,2-3,6-7H2,1H3,(H,16,17).
What are the key properties of 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one?
1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one has a molecular weight of 300.19 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]butan-1-one is sourced from PubChem (CID 23465988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).