About 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide
1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide (PubChem CID 13370376) has the molecular formula C12H14BrCl2N3O
and a molecular weight of 367.07 g/mol. Its IUPAC name is 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide.
Molecular Properties
| Compound Name | 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide |
| PubChem CID | 13370376 |
| Molecular Formula | C12H14BrCl2N3O |
| Molecular Weight | 367.07 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide |
| SMILES | Br.CC(=O)CN1CCN=C1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N3O.BrH/c1-8(18)7-17-5-4-15-12(17)16-11-3-2-9(13)6-10(11)14;/h2-3,6H,4-5,7H2,1H3,(H,15,16);1H |
| InChIKey | IABXFFOXFXDZLM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.07 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide?
The IUPAC name of 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide (CID 13370376) is 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide.
What is the SMILES notation for 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide?
The canonical SMILES for 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide is Br.CC(=O)CN1CCN=C1Nc1ccc(Cl)cc1Cl.
What is the InChIKey of 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide?
The InChIKey is IABXFFOXFXDZLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2N3O.BrH/c1-8(18)7-17-5-4-15-12(17)16-11-3-2-9(13)6-10(11)14;/h2-3,6H,4-5,7H2,1H3,(H,15,16);1H.
What are the key properties of 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide?
1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide has a molecular weight of 367.07 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]propan-2-one;hydrobromide is sourced from PubChem (CID 13370376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).