C12H14N2O6S — CID 174808286
(3-nitrophenyl)sulfonyl (2R)-1-methylpyrrolidine-2-carboxylate (PubChem CID 174808286) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is (3-nitrophenyl)sulfonyl (2R)-1-methylpyrrolidine-2-carboxylate.
| Compound Name | (3-nitrophenyl)sulfonyl (2R)-1-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 174808286 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (3-nitrophenyl)sulfonyl (2R)-1-methylpyrrolidine-2-carboxylate |
| SMILES | CN1CCC[C@@H]1C(=O)OS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N2O6S/c1-13-7-3-6-11(13)12(15)20-21(18,19)10-5-2-4-9(8-10)14(16)17/h2,4-5,8,11H,3,6-7H2,1H3/t11-/m1/s1 |
| InChIKey | SSDQOQBXERWTTC-LLVKDONJSA-N |
| XLogP | 0.92 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|