C13H21NO5 — CID 174810204
(3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;toluene (PubChem CID 174810204) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is (3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;toluene.
| Compound Name | (3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;toluene |
|---|---|
| PubChem CID | 174810204 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;toluene |
| SMILES | Cc1ccccc1.N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H8.C6H13NO5/c1-7-5-3-2-4-6-7;7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6H,1H3;2-6,8-11H,1,7H2/t;2-,3-,4+,5-,6?/m.1/s1 |
| InChIKey | IHSZYJAHCOYQGQ-MSPHXDAXSA-N |
| XLogP | -1.26 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |