C19H24N4OS — CID 17481167
2-[[4-(2,5-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-ethylpent-1-yn-3-yl)acetamide (PubChem CID 17481167) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 2-[[4-(2,5-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-ethylpent-1-yn-3-yl)acetamide.
| Compound Name | 2-[[4-(2,5-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-ethylpent-1-yn-3-yl)acetamide |
|---|---|
| PubChem CID | 17481167 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[[4-(2,5-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-ethylpent-1-yn-3-yl)acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)CSc1nncn1-c1cc(C)ccc1C |
| InChI | InChI=1S/C19H24N4OS/c1-6-19(7-2,8-3)21-17(24)12-25-18-22-20-13-23(18)16-11-14(4)9-10-15(16)5/h1,9-11,13H,7-8,12H2,2-5H3,(H,21,24) |
| InChIKey | LIVUEHLYAGMSRC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|