C11H10ClN3O2 — CID 174812553
2-(4-amino-6-chloro-1,5-naphthyridin-3-yl)ethyl formate (PubChem CID 174812553) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is 2-(4-amino-6-chloro-1,5-naphthyridin-3-yl)ethyl formate.
| Compound Name | 2-(4-amino-6-chloro-1,5-naphthyridin-3-yl)ethyl formate |
|---|---|
| PubChem CID | 174812553 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-(4-amino-6-chloro-1,5-naphthyridin-3-yl)ethyl formate |
| SMILES | Nc1c(CCOC=O)cnc2ccc(Cl)nc12 |
| InChI | InChI=1S/C11H10ClN3O2/c12-9-2-1-8-11(15-9)10(13)7(5-14-8)3-4-17-6-16/h1-2,5-6H,3-4H2,(H2,13,14) |
| InChIKey | CSYTZDSFBMZLQY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|