C21H28BrN3O4 — CID 174812608
3-(1-bromoethyl)-N-[2-(dimethylamino)ethyl]-N-methyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide (PubChem CID 174812608) has the molecular formula C21H28BrN3O4 and a molecular weight of 466.38 g/mol. Its IUPAC name is 3-(1-bromoethyl)-N-[2-(dimethylamino)ethyl]-N-methyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide.
| Compound Name | 3-(1-bromoethyl)-N-[2-(dimethylamino)ethyl]-N-methyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide |
|---|---|
| PubChem CID | 174812608 |
| Molecular Formula | C21H28BrN3O4 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 3-(1-bromoethyl)-N-[2-(dimethylamino)ethyl]-N-methyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide |
| SMILES | CC(Br)c1c(N2CCOCC2)oc2ccc(C(=O)N(C)CCN(C)C)cc2c1=O |
| InChI | InChI=1S/C21H28BrN3O4/c1-14(22)18-19(26)16-13-15(20(27)24(4)8-7-23(2)3)5-6-17(16)29-21(18)25-9-11-28-12-10-25/h5-6,13-14H,7-12H2,1-4H3 |
| InChIKey | KVOUYGIWPWOIRT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|