About 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium
1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium (PubChem CID 174813239) has the molecular formula C8H14N3O4Re
and a molecular weight of 402.42 g/mol. Its IUPAC name is 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium.
Molecular Properties
| Compound Name | 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium |
| PubChem CID | 174813239 |
| Molecular Formula | C8H14N3O4Re |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium |
| SMILES | C=Cn1ccnc1C(N)CC.O=[Re](=O)(=O)O |
| InChI | InChI=1S/C8H13N3.H2O.3O.Re/c1-3-7(9)8-10-5-6-11(8)4-2;;;;;/h4-7H,2-3,9H2,1H3;1H2;;;;/q;;;;;+1/p-1 |
| InChIKey | NUOMBZJUQJPQMN-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium?
The IUPAC name of 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium (CID 174813239) is 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium.
What is the SMILES notation for 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium?
The canonical SMILES for 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium is C=Cn1ccnc1C(N)CC.O=[Re](=O)(=O)O.
What is the InChIKey of 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium?
The InChIKey is NUOMBZJUQJPQMN-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H13N3.H2O.3O.Re/c1-3-7(9)8-10-5-6-11(8)4-2;;;;;/h4-7H,2-3,9H2,1H3;1H2;;;;/q;;;;;+1/p-1.
What are the key properties of 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium?
1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium has a molecular weight of 402.42 g/mol, XLogP of 0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethenylimidazol-2-yl)propan-1-amine;hydroxy(trioxo)rhenium is sourced from PubChem (CID 174813239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).