C9H16N2O7S2 — CID 174577179
4-(1-ethenylimidazol-2-yl)butane-2-sulfonic acid;sulfuric acid (PubChem CID 174577179) has the molecular formula C9H16N2O7S2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-(1-ethenylimidazol-2-yl)butane-2-sulfonic acid;sulfuric acid.
| Compound Name | 4-(1-ethenylimidazol-2-yl)butane-2-sulfonic acid;sulfuric acid |
|---|---|
| PubChem CID | 174577179 |
| Molecular Formula | C9H16N2O7S2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 4-(1-ethenylimidazol-2-yl)butane-2-sulfonic acid;sulfuric acid |
| SMILES | C=Cn1ccnc1CCC(C)S(=O)(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C9H14N2O3S.H2O4S/c1-3-11-7-6-10-9(11)5-4-8(2)15(12,13)14;1-5(2,3)4/h3,6-8H,1,4-5H2,2H3,(H,12,13,14);(H2,1,2,3,4) |
| InChIKey | PWCUSUZJDCWHBJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|