C8H13N3O4S — CID 63293623
2-[(1-methylimidazol-2-yl)methylsulfamoyl]propanoic acid (PubChem CID 63293623) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-[(1-methylimidazol-2-yl)methylsulfamoyl]propanoic acid.
| Compound Name | 2-[(1-methylimidazol-2-yl)methylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 63293623 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-[(1-methylimidazol-2-yl)methylsulfamoyl]propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)NCc1nccn1C |
| InChI | InChI=1S/C8H13N3O4S/c1-6(8(12)13)16(14,15)10-5-7-9-3-4-11(7)2/h3-4,6,10H,5H2,1-2H3,(H,12,13) |
| InChIKey | NEMONHRKRUAHJB-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |