C8H13F3N2O4S — CID 174876440
3-(1-methylimidazol-2-yl)propan-1-ol;trifluoromethanesulfonic acid (PubChem CID 174876440) has the molecular formula C8H13F3N2O4S and a molecular weight of 290.26 g/mol. Its IUPAC name is 3-(1-methylimidazol-2-yl)propan-1-ol;trifluoromethanesulfonic acid.
| Compound Name | 3-(1-methylimidazol-2-yl)propan-1-ol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 174876440 |
| Molecular Formula | C8H13F3N2O4S |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-(1-methylimidazol-2-yl)propan-1-ol;trifluoromethanesulfonic acid |
| SMILES | Cn1ccnc1CCCO.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C7H12N2O.CHF3O3S/c1-9-5-4-8-7(9)3-2-6-10;2-1(3,4)8(5,6)7/h4-5,10H,2-3,6H2,1H3;(H,5,6,7) |
| InChIKey | MSPZJSUVXHDJRS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|