About (N-bromo-2-nitroanilino) formate
(N-bromo-2-nitroanilino) formate (PubChem CID 174813515) has the molecular formula C7H5BrN2O4
and a molecular weight of 261.03 g/mol. Its IUPAC name is (N-bromo-2-nitroanilino) formate.
Molecular Properties
| Compound Name | (N-bromo-2-nitroanilino) formate |
| PubChem CID | 174813515 |
| Molecular Formula | C7H5BrN2O4 |
| Molecular Weight | 261.03 g/mol |
| Exact Mass | 259.94 |
| IUPAC Name | (N-bromo-2-nitroanilino) formate |
| SMILES | O=CON(Br)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5BrN2O4/c8-9(14-5-11)6-3-1-2-4-7(6)10(12)13/h1-5H |
| InChIKey | YWSDVIDVAGZRMB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.03 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (N-bromo-2-nitroanilino) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N-bromo-2-nitroanilino) formate?
The IUPAC name of (N-bromo-2-nitroanilino) formate (CID 174813515) is (N-bromo-2-nitroanilino) formate.
What is the SMILES notation for (N-bromo-2-nitroanilino) formate?
The canonical SMILES for (N-bromo-2-nitroanilino) formate is O=CON(Br)c1ccccc1[N+](=O)[O-].
What is the InChIKey of (N-bromo-2-nitroanilino) formate?
The InChIKey is YWSDVIDVAGZRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN2O4/c8-9(14-5-11)6-3-1-2-4-7(6)10(12)13/h1-5H.
What are the key properties of (N-bromo-2-nitroanilino) formate?
(N-bromo-2-nitroanilino) formate has a molecular weight of 261.03 g/mol, XLogP of 1.80, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (N-bromo-2-nitroanilino) formate is sourced from PubChem (CID 174813515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).