About phenol;N-phenoxyacetamide
phenol;N-phenoxyacetamide (PubChem CID 174815044) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is phenol;N-phenoxyacetamide.
Molecular Properties
| Compound Name | phenol;N-phenoxyacetamide |
| PubChem CID | 174815044 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | phenol;N-phenoxyacetamide |
| SMILES | CC(=O)NOc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C6H6O/c1-7(10)9-11-8-5-3-2-4-6-8;7-6-4-2-1-3-5-6/h2-6H,1H3,(H,9,10);1-5,7H |
| InChIKey | KBKOPBUKJVZLFA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenol;N-phenoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;N-phenoxyacetamide?
The IUPAC name of phenol;N-phenoxyacetamide (CID 174815044) is phenol;N-phenoxyacetamide.
What is the SMILES notation for phenol;N-phenoxyacetamide?
The canonical SMILES for phenol;N-phenoxyacetamide is CC(=O)NOc1ccccc1.Oc1ccccc1.
What is the InChIKey of phenol;N-phenoxyacetamide?
The InChIKey is KBKOPBUKJVZLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C6H6O/c1-7(10)9-11-8-5-3-2-4-6-8;7-6-4-2-1-3-5-6/h2-6H,1H3,(H,9,10);1-5,7H.
What are the key properties of phenol;N-phenoxyacetamide?
phenol;N-phenoxyacetamide has a molecular weight of 245.28 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;N-phenoxyacetamide is sourced from PubChem (CID 174815044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).