About acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine
acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine (PubChem CID 160787264) has the molecular formula C16H20N2O5
and a molecular weight of 320.35 g/mol. Its IUPAC name is acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine.
Molecular Properties
| Compound Name | acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine |
| PubChem CID | 160787264 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine |
| SMILES | CC(=O)NOc1ccccc1.CC(=O)O.NOc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C6H7NO.C2H4O2/c1-7(10)9-11-8-5-3-2-4-6-8;7-8-6-4-2-1-3-5-6;1-2(3)4/h2-6H,1H3,(H,9,10);1-5H,7H2;1H3,(H,3,4) |
| InChIKey | GERRTOSRDNGXPF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine?
The IUPAC name of acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine (CID 160787264) is acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine.
What is the SMILES notation for acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine?
The canonical SMILES for acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine is CC(=O)NOc1ccccc1.CC(=O)O.NOc1ccccc1.
What is the InChIKey of acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine?
The InChIKey is GERRTOSRDNGXPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C6H7NO.C2H4O2/c1-7(10)9-11-8-5-3-2-4-6-8;7-8-6-4-2-1-3-5-6;1-2(3)4/h2-6H,1H3,(H,9,10);1-5H,7H2;1H3,(H,3,4).
What are the key properties of acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine?
acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine has a molecular weight of 320.35 g/mol, XLogP of 2.15, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N-phenoxyacetamide;O-phenylhydroxylamine is sourced from PubChem (CID 160787264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).