C11H8ClNO2 — CID 174815363
3-(3-methylphenyl)-1,2-oxazole-4-carbonyl chloride (PubChem CID 174815363) has the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. Its IUPAC name is 3-(3-methylphenyl)-1,2-oxazole-4-carbonyl chloride.
| Compound Name | 3-(3-methylphenyl)-1,2-oxazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 174815363 |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 3-(3-methylphenyl)-1,2-oxazole-4-carbonyl chloride |
| SMILES | Cc1cccc(-c2nocc2C(=O)Cl)c1 |
| InChI | InChI=1S/C11H8ClNO2/c1-7-3-2-4-8(5-7)10-9(11(12)14)6-15-13-10/h2-6H,1H3 |
| InChIKey | SLTKYPPCGMCZQV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|