About 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol
3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol (PubChem CID 174815972) has the molecular formula C13H8ClF3I2O2
and a molecular weight of 542.46 g/mol. Its IUPAC name is 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol |
| PubChem CID | 174815972 |
| Molecular Formula | C13H8ClF3I2O2 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.83 |
| IUPAC Name | 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol |
| SMILES | Oc1ccc(C(F)(F)F)cc1I.Oc1cccc(Cl)c1I |
| InChI | InChI=1S/C7H4F3IO.C6H4ClIO/c8-7(9,10)4-1-2-6(12)5(11)3-4;7-4-2-1-3-5(9)6(4)8/h1-3,12H;1-3,9H |
| InChIKey | IEWAOHXGXFHEQM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol?
The IUPAC name of 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol (CID 174815972) is 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol.
What is the SMILES notation for 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol?
The canonical SMILES for 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol is Oc1ccc(C(F)(F)F)cc1I.Oc1cccc(Cl)c1I.
What is the InChIKey of 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol?
The InChIKey is IEWAOHXGXFHEQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3IO.C6H4ClIO/c8-7(9,10)4-1-2-6(12)5(11)3-4;7-4-2-1-3-5(9)6(4)8/h1-3,12H;1-3,9H.
What are the key properties of 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol?
3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol has a molecular weight of 542.46 g/mol, XLogP of 5.67, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-iodophenol;2-iodo-4-(trifluoromethyl)phenol is sourced from PubChem (CID 174815972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).