C10H13N2O3S- — CID 174817114
[[(2S)-2-amino-3-phenylpropanoyl]amino]methanesulfinate (PubChem CID 174817114) has the molecular formula C10H13N2O3S- and a molecular weight of 241.29 g/mol. Its IUPAC name is [[(2S)-2-amino-3-phenylpropanoyl]amino]methanesulfinate.
| Compound Name | [[(2S)-2-amino-3-phenylpropanoyl]amino]methanesulfinate |
|---|---|
| PubChem CID | 174817114 |
| Molecular Formula | C10H13N2O3S- |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | [[(2S)-2-amino-3-phenylpropanoyl]amino]methanesulfinate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCS(=O)[O-] |
| InChI | InChI=1S/C10H14N2O3S/c11-9(10(13)12-7-16(14)15)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)(H,14,15)/p-1/t9-/m0/s1 |
| InChIKey | FTZLUCFYZWCFIZ-VIFPVBQESA-M |
| XLogP | -0.49 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|