C26H29NO7S2 — CID 174818638
4-methyl-3-methylsulfonylbenzamide;3-(4-methylphenyl)-5-propylsulfonylbenzoic acid (PubChem CID 174818638) has the molecular formula C26H29NO7S2 and a molecular weight of 531.65 g/mol. Its IUPAC name is 4-methyl-3-methylsulfonylbenzamide;3-(4-methylphenyl)-5-propylsulfonylbenzoic acid.
| Compound Name | 4-methyl-3-methylsulfonylbenzamide;3-(4-methylphenyl)-5-propylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 174818638 |
| Molecular Formula | C26H29NO7S2 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 4-methyl-3-methylsulfonylbenzamide;3-(4-methylphenyl)-5-propylsulfonylbenzoic acid |
| SMILES | CCCS(=O)(=O)c1cc(C(=O)O)cc(-c2ccc(C)cc2)c1.Cc1ccc(C(N)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C17H18O4S.C9H11NO3S/c1-3-8-22(20,21)16-10-14(9-15(11-16)17(18)19)13-6-4-12(2)5-7-13;1-6-3-4-7(9(10)11)5-8(6)14(2,12)13/h4-7,9-11H,3,8H2,1-2H3,(H,18,19);3-5H,1-2H3,(H2,10,11) |
| InChIKey | WDWPKTUWBCYODR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |