C11H15NO3S — CID 118473526
N,N,4-trimethyl-3-methylsulfonylbenzamide (PubChem CID 118473526) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is N,N,4-trimethyl-3-methylsulfonylbenzamide.
| Compound Name | N,N,4-trimethyl-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 118473526 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N,N,4-trimethyl-3-methylsulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)C)cc1S(C)(=O)=O |
| InChI | InChI=1S/C11H15NO3S/c1-8-5-6-9(11(13)12(2)3)7-10(8)16(4,14)15/h5-7H,1-4H3 |
| InChIKey | MJCSXNPXSYZAKJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |