C10H14N2O3S — CID 63360505
4-amino-N,N-dimethyl-3-methylsulfonylbenzamide (PubChem CID 63360505) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-methylsulfonylbenzamide.
| Compound Name | 4-amino-N,N-dimethyl-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 63360505 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-methylsulfonylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C10H14N2O3S/c1-12(2)10(13)7-4-5-8(11)9(6-7)16(3,14)15/h4-6H,11H2,1-3H3 |
| InChIKey | PIULXYOKSCJMPZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|