C14H23N3O — CID 63360739
4-amino-N,N-dimethyl-3-[methyl(2-methylpropyl)amino]benzamide (PubChem CID 63360739) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-[methyl(2-methylpropyl)amino]benzamide.
| Compound Name | 4-amino-N,N-dimethyl-3-[methyl(2-methylpropyl)amino]benzamide |
|---|---|
| PubChem CID | 63360739 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-[methyl(2-methylpropyl)amino]benzamide |
| SMILES | CC(C)CN(C)c1cc(C(=O)N(C)C)ccc1N |
| InChI | InChI=1S/C14H23N3O/c1-10(2)9-17(5)13-8-11(6-7-12(13)15)14(18)16(3)4/h6-8,10H,9,15H2,1-5H3 |
| InChIKey | PTQANZQSGIMEMH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|