C17H27N3O — CID 82992948
3-amino-4-[cyclopropyl(3-methylbutyl)amino]-N,N-dimethylbenzamide (PubChem CID 82992948) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-amino-4-[cyclopropyl(3-methylbutyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-[cyclopropyl(3-methylbutyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 82992948 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 3-amino-4-[cyclopropyl(3-methylbutyl)amino]-N,N-dimethylbenzamide |
| SMILES | CC(C)CCN(c1ccc(C(=O)N(C)C)cc1N)C1CC1 |
| InChI | InChI=1S/C17H27N3O/c1-12(2)9-10-20(14-6-7-14)16-8-5-13(11-15(16)18)17(21)19(3)4/h5,8,11-12,14H,6-7,9-10,18H2,1-4H3 |
| InChIKey | IKFRWMFBJABGOT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|