C15H16N2O3 — CID 174820044
1-[morpholin-2-yl(phenyl)methyl]pyrrole-2,5-dione (PubChem CID 174820044) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-[morpholin-2-yl(phenyl)methyl]pyrrole-2,5-dione.
| Compound Name | 1-[morpholin-2-yl(phenyl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 174820044 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-[morpholin-2-yl(phenyl)methyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C(c1ccccc1)C1CNCCO1 |
| InChI | InChI=1S/C15H16N2O3/c18-13-6-7-14(19)17(13)15(11-4-2-1-3-5-11)12-10-16-8-9-20-12/h1-7,12,15-16H,8-10H2 |
| InChIKey | NNGTXNXSKYRRDA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|