C25H25N5O3 — CID 174820378
6-(2-amino-3-prop-2-enoylpyrrolidin-1-yl)-2-(4-phenoxyanilino)pyridine-3-carboxamide (PubChem CID 174820378) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 6-(2-amino-3-prop-2-enoylpyrrolidin-1-yl)-2-(4-phenoxyanilino)pyridine-3-carboxamide.
| Compound Name | 6-(2-amino-3-prop-2-enoylpyrrolidin-1-yl)-2-(4-phenoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 174820378 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 6-(2-amino-3-prop-2-enoylpyrrolidin-1-yl)-2-(4-phenoxyanilino)pyridine-3-carboxamide |
| SMILES | C=CC(=O)C1CCN(c2ccc(C(N)=O)c(Nc3ccc(Oc4ccccc4)cc3)n2)C1N |
| InChI | InChI=1S/C25H25N5O3/c1-2-21(31)19-14-15-30(23(19)26)22-13-12-20(24(27)32)25(29-22)28-16-8-10-18(11-9-16)33-17-6-4-3-5-7-17/h2-13,19,23H,1,14-15,26H2,(H2,27,32)(H,28,29) |
| InChIKey | OKPKKONNAYZEMF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|