C25H22N4O4 — CID 138722523
2-(4-phenoxyphenoxy)-6-[(1S)-5-prop-2-enoyl-2,5-diazabicyclo[2.2.0]hexan-2-yl]pyridine-3-carboxamide (PubChem CID 138722523) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 2-(4-phenoxyphenoxy)-6-[(1S)-5-prop-2-enoyl-2,5-diazabicyclo[2.2.0]hexan-2-yl]pyridine-3-carboxamide.
| Compound Name | 2-(4-phenoxyphenoxy)-6-[(1S)-5-prop-2-enoyl-2,5-diazabicyclo[2.2.0]hexan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138722523 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-(4-phenoxyphenoxy)-6-[(1S)-5-prop-2-enoyl-2,5-diazabicyclo[2.2.0]hexan-2-yl]pyridine-3-carboxamide |
| SMILES | C=CC(=O)N1C[C@H]2C1CN2c1ccc(C(N)=O)c(Oc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C25H22N4O4/c1-2-23(30)29-15-20-21(29)14-28(20)22-13-12-19(24(26)31)25(27-22)33-18-10-8-17(9-11-18)32-16-6-4-3-5-7-16/h2-13,20-21H,1,14-15H2,(H2,26,31)/t20-,21?/m0/s1 |
| InChIKey | GFZPGYPQKGIKKX-BGERDNNASA-N |
| XLogP | 3.35 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|