C29H25N5O4 — CID 122534313
6-[(1R)-5-[(E)-2-cyano-3-cyclopropylprop-2-enoyl]-2,5-diazabicyclo[2.2.0]hexan-2-yl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide (PubChem CID 122534313) has the molecular formula C29H25N5O4 and a molecular weight of 507.55 g/mol. Its IUPAC name is 6-[(1R)-5-[(E)-2-cyano-3-cyclopropylprop-2-enoyl]-2,5-diazabicyclo[2.2.0]hexan-2-yl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide.
| Compound Name | 6-[(1R)-5-[(E)-2-cyano-3-cyclopropylprop-2-enoyl]-2,5-diazabicyclo[2.2.0]hexan-2-yl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122534313 |
| Molecular Formula | C29H25N5O4 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 6-[(1R)-5-[(E)-2-cyano-3-cyclopropylprop-2-enoyl]-2,5-diazabicyclo[2.2.0]hexan-2-yl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide |
| SMILES | N#C/C(=C\C1CC1)C(=O)N1C[C@@H]2C1CN2c1ccc(C(N)=O)c(Oc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C29H25N5O4/c30-15-19(14-18-6-7-18)29(36)34-17-24-25(34)16-33(24)26-13-12-23(27(31)35)28(32-26)38-22-10-8-21(9-11-22)37-20-4-2-1-3-5-20/h1-5,8-14,18,24-25H,6-7,16-17H2,(H2,31,35)/b19-14+/t24-,25?/m1/s1 |
| InChIKey | WNTAMULUYVVTPC-ZHFIYYECSA-N |
| XLogP | 4.02 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|