About (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane
(2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane (PubChem CID 174822261) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane.
Molecular Properties
| Compound Name | (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane |
| PubChem CID | 174822261 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane |
| SMILES | CC/C(C)=C1\C(C)CCCC1(C)C |
| InChI | InChI=1S/C13H24/c1-6-10(2)12-11(3)8-7-9-13(12,4)5/h11H,6-9H2,1-5H3/b12-10+ |
| InChIKey | DULOHRHRTPGPAL-ZRDIBKRKSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane?
The IUPAC name of (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane (CID 174822261) is (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane.
What is the SMILES notation for (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane?
The canonical SMILES for (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane is CC/C(C)=C1\C(C)CCCC1(C)C.
What is the InChIKey of (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane?
The InChIKey is DULOHRHRTPGPAL-ZRDIBKRKSA-N. The full InChI is InChI=1S/C13H24/c1-6-10(2)12-11(3)8-7-9-13(12,4)5/h11H,6-9H2,1-5H3/b12-10+.
What are the key properties of (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane?
(2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane has a molecular weight of 180.33 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-butan-2-ylidene-1,1,3-trimethylcyclohexane is sourced from PubChem (CID 174822261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).