C25H33NO3 — CID 174825203
2-tert-butylbenzene-1,4-diol;5-tert-butyl-2-ethoxyquinoline (PubChem CID 174825203) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is 2-tert-butylbenzene-1,4-diol;5-tert-butyl-2-ethoxyquinoline.
| Compound Name | 2-tert-butylbenzene-1,4-diol;5-tert-butyl-2-ethoxyquinoline |
|---|---|
| PubChem CID | 174825203 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 2-tert-butylbenzene-1,4-diol;5-tert-butyl-2-ethoxyquinoline |
| SMILES | CC(C)(C)c1cc(O)ccc1O.CCOc1ccc2c(C(C)(C)C)cccc2n1 |
| InChI | InChI=1S/C15H19NO.C10H14O2/c1-5-17-14-10-9-11-12(15(2,3)4)7-6-8-13(11)16-14;1-10(2,3)8-6-7(11)4-5-9(8)12/h6-10H,5H2,1-4H3;4-6,11-12H,1-3H3 |
| InChIKey | SGEXDZPGOXWDPO-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|