C29H29N3O5 — CID 17482899
1-(3-benzamido-3-phenylpropanoyl)-N-(1,3-benzodioxol-5-yl)piperidine-4-carboxamide (PubChem CID 17482899) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is 1-(3-benzamido-3-phenylpropanoyl)-N-(1,3-benzodioxol-5-yl)piperidine-4-carboxamide.
| Compound Name | 1-(3-benzamido-3-phenylpropanoyl)-N-(1,3-benzodioxol-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17482899 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 1-(3-benzamido-3-phenylpropanoyl)-N-(1,3-benzodioxol-5-yl)piperidine-4-carboxamide |
| SMILES | O=C(NC(CC(=O)N1CCC(C(=O)Nc2ccc3c(c2)OCO3)CC1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29N3O5/c33-27(18-24(20-7-3-1-4-8-20)31-29(35)21-9-5-2-6-10-21)32-15-13-22(14-16-32)28(34)30-23-11-12-25-26(17-23)37-19-36-25/h1-12,17,22,24H,13-16,18-19H2,(H,30,34)(H,31,35) |
| InChIKey | ZJPYCEYQDOMOOG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |