C27H25N8O2+ — CID 174829221
[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzoyl]imino-(pyridin-3-ylmethylimino)azanium (PubChem CID 174829221) has the molecular formula C27H25N8O2+ and a molecular weight of 493.55 g/mol. Its IUPAC name is [4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzoyl]imino-(pyridin-3-ylmethylimino)azanium.
| Compound Name | [4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzoyl]imino-(pyridin-3-ylmethylimino)azanium |
|---|---|
| PubChem CID | 174829221 |
| Molecular Formula | C27H25N8O2+ |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | [4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzoyl]imino-(pyridin-3-ylmethylimino)azanium |
| SMILES | O=C(N=[N+]=NCc1cccnc1)c1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C27H24N8O2/c36-26(33-34-30-19-20-2-1-12-28-18-20)22-5-3-21(4-6-22)25-11-13-29-27(32-25)31-23-7-9-24(10-8-23)35-14-16-37-17-15-35/h1-13,18H,14-17,19H2/p+1 |
| InChIKey | DKAQGPACBKCHES-UHFFFAOYSA-O |
| XLogP | 4.43 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|