C19H29NO — CID 174829434
2-methyl-N-[[3-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]prop-2-enamide (PubChem CID 174829434) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-methyl-N-[[3-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[[3-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 174829434 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-methyl-N-[[3-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCc1cccc(C(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C19H29NO/c1-14(2)17(21)20-12-15-9-8-10-16(11-15)19(6,7)13-18(3,4)5/h8-11H,1,12-13H2,2-7H3,(H,20,21) |
| InChIKey | KBBJJOVDBBYEMB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|