2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid

C16H25NO2 — CID 151329473

IUPAC2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid
SMILESCC(C)(C)CC(C)(C)c1cccc(NCC(=O)O)c1
InChIInChI=1S/C16H25NO2/c1-15(2,3)11-16(4,5)12-7-6-8-13(9-12)17-10-14(18)19/h6-9,17H,10-11H2,1-5H3,(H,18,19)
InChIKeyOIDMHCPWVBOGIV-UHFFFAOYSA-N
MW263.38 g/mol
LogP3.90
Rot. Bonds5

About 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid

2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid (PubChem CID 151329473) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid.

Molecular Properties

Compound Name2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid
PubChem CID151329473
Molecular FormulaC16H25NO2
Molecular Weight263.38 g/mol
Exact Mass263.19
IUPAC Name2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid
SMILESCC(C)(C)CC(C)(C)c1cccc(NCC(=O)O)c1
InChIInChI=1S/C16H25NO2/c1-15(2,3)11-16(4,5)12-7-6-8-13(9-12)17-10-14(18)19/h6-9,17H,10-11H2,1-5H3,(H,18,19)
InChIKeyOIDMHCPWVBOGIV-UHFFFAOYSA-N
XLogP3.90
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.38
LogP ≤ 53.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid?
The IUPAC name of 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid (CID 151329473) is 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid.
What is the SMILES notation for 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid?
The canonical SMILES for 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid is CC(C)(C)CC(C)(C)c1cccc(NCC(=O)O)c1.
What is the InChIKey of 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid?
The InChIKey is OIDMHCPWVBOGIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-15(2,3)11-16(4,5)12-7-6-8-13(9-12)17-10-14(18)19/h6-9,17H,10-11H2,1-5H3,(H,18,19).
What are the key properties of 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid?
2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid has a molecular weight of 263.38 g/mol, XLogP of 3.90, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,4,4-trimethylpentan-2-yl)anilino]acetic acid is sourced from PubChem (CID 151329473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).