C22H29NOS — CID 54499722
N-(3-methylphenyl)-2-sulfanyl-5-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 54499722) has the molecular formula C22H29NOS and a molecular weight of 355.55 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-sulfanyl-5-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | N-(3-methylphenyl)-2-sulfanyl-5-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 54499722 |
| Molecular Formula | C22H29NOS |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-(3-methylphenyl)-2-sulfanyl-5-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2cc(C(C)(C)CC(C)(C)C)ccc2S)c1 |
| InChI | InChI=1S/C22H29NOS/c1-15-8-7-9-17(12-15)23-20(24)18-13-16(10-11-19(18)25)22(5,6)14-21(2,3)4/h7-13,25H,14H2,1-6H3,(H,23,24) |
| InChIKey | YBOZVDHOEOFVCG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|