C11H13ClN6O4S — CID 174829905
N'-[(4-chlorofuran-2-yl)methyl]-N-hydroxy-4-[2-(sulfonylamino)ethylamino]pyrazole-1-carboximidamide (PubChem CID 174829905) has the molecular formula C11H13ClN6O4S and a molecular weight of 360.78 g/mol. Its IUPAC name is N'-[(4-chlorofuran-2-yl)methyl]-N-hydroxy-4-[2-(sulfonylamino)ethylamino]pyrazole-1-carboximidamide.
| Compound Name | N'-[(4-chlorofuran-2-yl)methyl]-N-hydroxy-4-[2-(sulfonylamino)ethylamino]pyrazole-1-carboximidamide |
|---|---|
| PubChem CID | 174829905 |
| Molecular Formula | C11H13ClN6O4S |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | N'-[(4-chlorofuran-2-yl)methyl]-N-hydroxy-4-[2-(sulfonylamino)ethylamino]pyrazole-1-carboximidamide |
| SMILES | O=S(=O)=NCCNc1cnn(/C(=N/Cc2cc(Cl)co2)NO)c1 |
| InChI | InChI=1S/C11H13ClN6O4S/c12-8-3-10(22-7-8)5-14-11(17-19)18-6-9(4-15-18)13-1-2-16-23(20)21/h3-4,6-7,13,19H,1-2,5H2,(H,14,17) |
| InChIKey | NSNYPGPUBRNEHJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|