C20H22FN3O4S — CID 174831357
amino N-[1-[1-(4-cyanophenyl)ethylsulfonyl]butan-2-yl]-N-(4-fluorophenyl)carbamate (PubChem CID 174831357) has the molecular formula C20H22FN3O4S and a molecular weight of 419.48 g/mol. Its IUPAC name is amino N-[1-[1-(4-cyanophenyl)ethylsulfonyl]butan-2-yl]-N-(4-fluorophenyl)carbamate.
| Compound Name | amino N-[1-[1-(4-cyanophenyl)ethylsulfonyl]butan-2-yl]-N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 174831357 |
| Molecular Formula | C20H22FN3O4S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | amino N-[1-[1-(4-cyanophenyl)ethylsulfonyl]butan-2-yl]-N-(4-fluorophenyl)carbamate |
| SMILES | CCC(CS(=O)(=O)C(C)c1ccc(C#N)cc1)N(C(=O)ON)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FN3O4S/c1-3-18(24(20(25)28-23)19-10-8-17(21)9-11-19)13-29(26,27)14(2)16-6-4-15(12-22)5-7-16/h4-11,14,18H,3,13,23H2,1-2H3 |
| InChIKey | XCIUKZPQEVLZMP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|