C20H21FN2O4S — CID 89268662
(4-fluorophenyl) N-[(2R)-1-[(1S)-1-(4-cyanophenyl)ethyl]sulfonylbutan-2-yl]carbamate (PubChem CID 89268662) has the molecular formula C20H21FN2O4S and a molecular weight of 404.46 g/mol. Its IUPAC name is (4-fluorophenyl) N-[(2R)-1-[(1S)-1-(4-cyanophenyl)ethyl]sulfonylbutan-2-yl]carbamate.
| Compound Name | (4-fluorophenyl) N-[(2R)-1-[(1S)-1-(4-cyanophenyl)ethyl]sulfonylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 89268662 |
| Molecular Formula | C20H21FN2O4S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (4-fluorophenyl) N-[(2R)-1-[(1S)-1-(4-cyanophenyl)ethyl]sulfonylbutan-2-yl]carbamate |
| SMILES | CC[C@H](CS(=O)(=O)[C@@H](C)c1ccc(C#N)cc1)NC(=O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN2O4S/c1-3-18(23-20(24)27-19-10-8-17(21)9-11-19)13-28(25,26)14(2)16-6-4-15(12-22)5-7-16/h4-11,14,18H,3,13H2,1-2H3,(H,23,24)/t14-,18+/m0/s1 |
| InChIKey | GIWOBQLAIGEECV-KBXCAEBGSA-N |
| XLogP | 3.74 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |