C16H30N4O2 — CID 174832631
2-amino-4-methyl-N-(4-methyl-5-pentylpyrimidin-2-yl)pentanamide;hydrate (PubChem CID 174832631) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-amino-4-methyl-N-(4-methyl-5-pentylpyrimidin-2-yl)pentanamide;hydrate.
| Compound Name | 2-amino-4-methyl-N-(4-methyl-5-pentylpyrimidin-2-yl)pentanamide;hydrate |
|---|---|
| PubChem CID | 174832631 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 2-amino-4-methyl-N-(4-methyl-5-pentylpyrimidin-2-yl)pentanamide;hydrate |
| SMILES | CCCCCc1cnc(NC(=O)C(N)CC(C)C)nc1C.O |
| InChI | InChI=1S/C16H28N4O.H2O/c1-5-6-7-8-13-10-18-16(19-12(13)4)20-15(21)14(17)9-11(2)3;/h10-11,14H,5-9,17H2,1-4H3,(H,18,19,20,21);1H2 |
| InChIKey | YJUBYLGZIAEFSB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|