C16H16F3N3O3 — CID 174836469
5-[2-hydroxyethyl(methyl)amino]-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 174836469) has the molecular formula C16H16F3N3O3 and a molecular weight of 355.32 g/mol. Its IUPAC name is 5-[2-hydroxyethyl(methyl)amino]-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 5-[2-hydroxyethyl(methyl)amino]-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 174836469 |
| Molecular Formula | C16H16F3N3O3 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 5-[2-hydroxyethyl(methyl)amino]-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | CN(CCO)c1cncc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H16F3N3O3/c1-22(6-7-23)13-8-11(9-20-10-13)15(24)21-12-2-4-14(5-3-12)25-16(17,18)19/h2-5,8-10,23H,6-7H2,1H3,(H,21,24) |
| InChIKey | MCBCSLYHONEVHT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |