About octylphosphane;tetramethylphosphanium;bromide
octylphosphane;tetramethylphosphanium;bromide (PubChem CID 174836712) has the molecular formula C12H31BrP2
and a molecular weight of 317.23 g/mol. Its IUPAC name is octylphosphane;tetramethylphosphanium;bromide.
Molecular Properties
| Compound Name | octylphosphane;tetramethylphosphanium;bromide |
| PubChem CID | 174836712 |
| Molecular Formula | C12H31BrP2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | octylphosphane;tetramethylphosphanium;bromide |
| SMILES | CCCCCCCCP.C[P+](C)(C)C.[Br-] |
| InChI | InChI=1S/C8H19P.C4H12P.BrH/c1-2-3-4-5-6-7-8-9;1-5(2,3)4;/h2-9H2,1H3;1-4H3;1H/q;+1;/p-1 |
| InChIKey | VMDSOKVMIANXED-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze octylphosphane;tetramethylphosphanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octylphosphane;tetramethylphosphanium;bromide?
The IUPAC name of octylphosphane;tetramethylphosphanium;bromide (CID 174836712) is octylphosphane;tetramethylphosphanium;bromide.
What is the SMILES notation for octylphosphane;tetramethylphosphanium;bromide?
The canonical SMILES for octylphosphane;tetramethylphosphanium;bromide is CCCCCCCCP.C[P+](C)(C)C.[Br-].
What is the InChIKey of octylphosphane;tetramethylphosphanium;bromide?
The InChIKey is VMDSOKVMIANXED-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H19P.C4H12P.BrH/c1-2-3-4-5-6-7-8-9;1-5(2,3)4;/h2-9H2,1H3;1-4H3;1H/q;+1;/p-1.
What are the key properties of octylphosphane;tetramethylphosphanium;bromide?
octylphosphane;tetramethylphosphanium;bromide has a molecular weight of 317.23 g/mol, XLogP of 1.75, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for octylphosphane;tetramethylphosphanium;bromide is sourced from PubChem (CID 174836712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).