C17H23N3O3 — CID 17483732
N-(2,4-dimethoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide (PubChem CID 17483732) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 17483732 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide |
| SMILES | COc1ccc(NC(=O)CCc2c(C)nn(C)c2C)c(OC)c1 |
| InChI | InChI=1S/C17H23N3O3/c1-11-14(12(2)20(3)19-11)7-9-17(21)18-15-8-6-13(22-4)10-16(15)23-5/h6,8,10H,7,9H2,1-5H3,(H,18,21) |
| InChIKey | QDYVWMCTIMBZQU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |