C19H24N6O3 — CID 23602199
3-[2-(aminomethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(2,4-dimethoxyphenyl)propanamide (PubChem CID 23602199) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(2,4-dimethoxyphenyl)propanamide.
| Compound Name | 3-[2-(aminomethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(2,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 23602199 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 3-[2-(aminomethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(2,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCc2c(C)nc3nc(CN)nn3c2C)c(OC)c1 |
| InChI | InChI=1S/C19H24N6O3/c1-11-14(12(2)25-19(21-11)23-17(10-20)24-25)6-8-18(26)22-15-7-5-13(27-3)9-16(15)28-4/h5,7,9H,6,8,10,20H2,1-4H3,(H,22,26) |
| InChIKey | UOTKKKSXZPZXDV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |