C21H28N6O3 — CID 23602217
3-[2-(aminomethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(2,5-diethoxyphenyl)propanamide (PubChem CID 23602217) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(2,5-diethoxyphenyl)propanamide.
| Compound Name | 3-[2-(aminomethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(2,5-diethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 23602217 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 3-[2-(aminomethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(2,5-diethoxyphenyl)propanamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CCc2c(C)nc3nc(CN)nn3c2C)c1 |
| InChI | InChI=1S/C21H28N6O3/c1-5-29-15-7-9-18(30-6-2)17(11-15)24-20(28)10-8-16-13(3)23-21-25-19(12-22)26-27(21)14(16)4/h7,9,11H,5-6,8,10,12,22H2,1-4H3,(H,24,28) |
| InChIKey | QSWACZRWBMPXTF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |