About potassium;bis(2-ethylhexyl) phosphate;urea
potassium;bis(2-ethylhexyl) phosphate;urea (PubChem CID 174839333) has the molecular formula C17H38KN2O5P
and a molecular weight of 420.57 g/mol. Its IUPAC name is potassium;bis(2-ethylhexyl) phosphate;urea.
Molecular Properties
| Compound Name | potassium;bis(2-ethylhexyl) phosphate;urea |
| PubChem CID | 174839333 |
| Molecular Formula | C17H38KN2O5P |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | potassium;bis(2-ethylhexyl) phosphate;urea |
| SMILES | CCCCC(CC)COP(=O)([O-])OCC(CC)CCCC.NC(N)=O.[K+] |
| InChI | InChI=1S/C16H35O4P.CH4N2O.K/c1-5-9-11-15(7-3)13-19-21(17,18)20-14-16(8-4)12-10-6-2;2-1(3)4;/h15-16H,5-14H2,1-4H3,(H,17,18);(H4,2,3,4);/q;;+1/p-1 |
| InChIKey | DMYCPRFPOSDBFA-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium;bis(2-ethylhexyl) phosphate;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;bis(2-ethylhexyl) phosphate;urea?
The IUPAC name of potassium;bis(2-ethylhexyl) phosphate;urea (CID 174839333) is potassium;bis(2-ethylhexyl) phosphate;urea.
What is the SMILES notation for potassium;bis(2-ethylhexyl) phosphate;urea?
The canonical SMILES for potassium;bis(2-ethylhexyl) phosphate;urea is CCCCC(CC)COP(=O)([O-])OCC(CC)CCCC.NC(N)=O.[K+].
What is the InChIKey of potassium;bis(2-ethylhexyl) phosphate;urea?
The InChIKey is DMYCPRFPOSDBFA-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H35O4P.CH4N2O.K/c1-5-9-11-15(7-3)13-19-21(17,18)20-14-16(8-4)12-10-6-2;2-1(3)4;/h15-16H,5-14H2,1-4H3,(H,17,18);(H4,2,3,4);/q;;+1/p-1.
What are the key properties of potassium;bis(2-ethylhexyl) phosphate;urea?
potassium;bis(2-ethylhexyl) phosphate;urea has a molecular weight of 420.57 g/mol, XLogP of 0.95, 14 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;bis(2-ethylhexyl) phosphate;urea is sourced from PubChem (CID 174839333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).