About zinc;oxalonitrile;sulfate
zinc;oxalonitrile;sulfate (PubChem CID 174840626) has the molecular formula C2N2O4SZn
and a molecular weight of 213.49 g/mol. Its IUPAC name is zinc;oxalonitrile;sulfate.
Molecular Properties
| Compound Name | zinc;oxalonitrile;sulfate |
| PubChem CID | 174840626 |
| Molecular Formula | C2N2O4SZn |
| Molecular Weight | 213.49 g/mol |
| Exact Mass | 211.89 |
| IUPAC Name | zinc;oxalonitrile;sulfate |
| SMILES | N#CC#N.O=S(=O)([O-])[O-].[Zn+2] |
| InChI | InChI=1S/C2N2.H2O4S.Zn/c3-1-2-4;1-5(2,3)4;/h;(H2,1,2,3,4);/q;;+2/p-2 |
| InChIKey | WKEHPQORRRUVAK-UHFFFAOYSA-L |
| XLogP | -1.31 |
| TPSA | 127.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.49 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze zinc;oxalonitrile;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;oxalonitrile;sulfate?
The IUPAC name of zinc;oxalonitrile;sulfate (CID 174840626) is zinc;oxalonitrile;sulfate.
What is the SMILES notation for zinc;oxalonitrile;sulfate?
The canonical SMILES for zinc;oxalonitrile;sulfate is N#CC#N.O=S(=O)([O-])[O-].[Zn+2].
What is the InChIKey of zinc;oxalonitrile;sulfate?
The InChIKey is WKEHPQORRRUVAK-UHFFFAOYSA-L. The full InChI is InChI=1S/C2N2.H2O4S.Zn/c3-1-2-4;1-5(2,3)4;/h;(H2,1,2,3,4);/q;;+2/p-2.
What are the key properties of zinc;oxalonitrile;sulfate?
zinc;oxalonitrile;sulfate has a molecular weight of 213.49 g/mol, XLogP of -1.31, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;oxalonitrile;sulfate is sourced from PubChem (CID 174840626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).