C21H25NO5S — CID 174843330
3-[4-[(2-butanoylphenyl)sulfamoyl]phenyl]-2,2-dimethylpropanoic acid (PubChem CID 174843330) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is 3-[4-[(2-butanoylphenyl)sulfamoyl]phenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-[(2-butanoylphenyl)sulfamoyl]phenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 174843330 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-[4-[(2-butanoylphenyl)sulfamoyl]phenyl]-2,2-dimethylpropanoic acid |
| SMILES | CCCC(=O)c1ccccc1NS(=O)(=O)c1ccc(CC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-4-7-19(23)17-8-5-6-9-18(17)22-28(26,27)16-12-10-15(11-13-16)14-21(2,3)20(24)25/h5-6,8-13,22H,4,7,14H2,1-3H3,(H,24,25) |
| InChIKey | AUFQTLTVKUBZNL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |