C14H21N3S — CID 174843781
2-(1-pyridin-3-ylpiperidin-4-yl)thiomorpholine (PubChem CID 174843781) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-(1-pyridin-3-ylpiperidin-4-yl)thiomorpholine.
| Compound Name | 2-(1-pyridin-3-ylpiperidin-4-yl)thiomorpholine |
|---|---|
| PubChem CID | 174843781 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-(1-pyridin-3-ylpiperidin-4-yl)thiomorpholine |
| SMILES | c1cncc(N2CCC(C3CNCCS3)CC2)c1 |
| InChI | InChI=1S/C14H21N3S/c1-2-13(10-15-5-1)17-7-3-12(4-8-17)14-11-16-6-9-18-14/h1-2,5,10,12,14,16H,3-4,6-9,11H2 |
| InChIKey | WHBYKRODAJPESS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |