C23H26O7S — CID 174844539
4-[2-(cyclohexylmethoxy)-5-(sulfinomethyl)phenyl]-6-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174844539) has the molecular formula C23H26O7S and a molecular weight of 446.52 g/mol. Its IUPAC name is 4-[2-(cyclohexylmethoxy)-5-(sulfinomethyl)phenyl]-6-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-[2-(cyclohexylmethoxy)-5-(sulfinomethyl)phenyl]-6-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174844539 |
| Molecular Formula | C23H26O7S |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-[2-(cyclohexylmethoxy)-5-(sulfinomethyl)phenyl]-6-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1cc(-c2cc(CS(=O)O)ccc2OCC2CCCCC2)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C23H26O7S/c1-14-9-18(20(23(26)27)11-17(14)22(24)25)19-10-16(13-31(28)29)7-8-21(19)30-12-15-5-3-2-4-6-15/h7-11,15H,2-6,12-13H2,1H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | ONYZZJYQJUAKPR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|