C20H17F2N3O6 — CID 17484747
[2-[[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 17484747) has the molecular formula C20H17F2N3O6 and a molecular weight of 433.37 g/mol. Its IUPAC name is [2-[[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl] 2,4-difluorobenzoate.
| Compound Name | [2-[[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 17484747 |
| Molecular Formula | C20H17F2N3O6 |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | [2-[[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | COc1ccc(C2(C)NC(=O)N(NC(=O)COC(=O)c3ccc(F)cc3F)C2=O)cc1 |
| InChI | InChI=1S/C20H17F2N3O6/c1-20(11-3-6-13(30-2)7-4-11)18(28)25(19(29)23-20)24-16(26)10-31-17(27)14-8-5-12(21)9-15(14)22/h3-9H,10H2,1-2H3,(H,23,29)(H,24,26) |
| InChIKey | NVRAVQNTZULGCV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|