About 2-silyloxan-3-ol
2-silyloxan-3-ol (PubChem CID 174848934) has the molecular formula C5H12O2Si
and a molecular weight of 132.23 g/mol. Its IUPAC name is 2-silyloxan-3-ol.
Molecular Properties
| Compound Name | 2-silyloxan-3-ol |
| PubChem CID | 174848934 |
| Molecular Formula | C5H12O2Si |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 2-silyloxan-3-ol |
| SMILES | OC1CCCOC1[SiH3] |
| InChI | InChI=1S/C5H12O2Si/c6-4-2-1-3-7-5(4)8/h4-6H,1-3H2,8H3 |
| InChIKey | MPSYGDNWZPABKP-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-silyloxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-silyloxan-3-ol?
The IUPAC name of 2-silyloxan-3-ol (CID 174848934) is 2-silyloxan-3-ol.
What is the SMILES notation for 2-silyloxan-3-ol?
The canonical SMILES for 2-silyloxan-3-ol is OC1CCCOC1[SiH3].
What is the InChIKey of 2-silyloxan-3-ol?
The InChIKey is MPSYGDNWZPABKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2Si/c6-4-2-1-3-7-5(4)8/h4-6H,1-3H2,8H3.
What are the key properties of 2-silyloxan-3-ol?
2-silyloxan-3-ol has a molecular weight of 132.23 g/mol, XLogP of -1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-silyloxan-3-ol is sourced from PubChem (CID 174848934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).