C8H9NO3 — CID 174849040
2-azabicyclo[2.2.0]hexa-1,3,5-triene;propaneperoxoic acid (PubChem CID 174849040) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-azabicyclo[2.2.0]hexa-1,3,5-triene;propaneperoxoic acid.
| Compound Name | 2-azabicyclo[2.2.0]hexa-1,3,5-triene;propaneperoxoic acid |
|---|---|
| PubChem CID | 174849040 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-azabicyclo[2.2.0]hexa-1,3,5-triene;propaneperoxoic acid |
| SMILES | CCC(=O)OO.c1cc2ncc1-2 |
| InChI | InChI=1S/C5H3N.C3H6O3/c1-2-5-4(1)3-6-5;1-2-3(4)6-5/h1-3H;5H,2H2,1H3 |
| InChIKey | PSGYHNBLKHMMSB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|